01904 488599Albendazole
Albendazole, United States Pharmacopeia (USP) Reference Standard
| technique(s): | Suspected of damaging fertility or the unborn child. May cause damage to organs through pronloged or repeated expposure if swal |
| manufacturer/tradename: | GHS08 |
| Antibody Form: | P260 - P280 |
| species reactivity: | 29339980900 |
| MSDS Link: | CCCSc1ccc2[nH]c(NC(=O)OC)nc2c1 |
| clone: | neat |
| Antibody Product Type: | pharmaceutical (small molecule) |
| CAS-Nummer: | 54965-21-8 |
X
Kunden kauften auch:
| eCl@ss | Shipped on ICE | ADRSuff | Net Weight | Tariff Number | Menge pro VE | Bestell Nr. | |
|---|---|---|---|---|---|---|---|
  | 32160000 | STD | 1 | Repr. 2,STOT RE 2 | H361-H373 | 1 | 1012553-200MG |