01904 488599Bis(2-ethylhexyl) maleate
Bis(2-ethylhexyl) maleate, United States Pharmacopeia (USP) Reference Standard
| technique(s): | May cause damage to organs through pronloged or repeated expposure if swallowed Very toxic to aquatic life. Very toxic to aquat |
| manufacturer/tradename: | GHS08,GHS09 |
| Antibody Form: | P260 |
| species reactivity: | 29171980900 |
| MSDS Link: | CCCCC(CC)COC(=O)\C=C/C(=O)OCC(CC)CCCC |
| clone: | 1S/C20H36O4/c1-5-9-11-17(7-3)15-23-19(21)13-14-20(22)24-16-18(8-4)12-10-6-2/h13-14,17-18H,5-12,15-16H2,1-4H3/b14-13- |
| Antibody Product Type: | pharmaceutical (small molecule) |
| CAS-Nummer: | 142-16-5 |
X
Kunden kauften auch:
| eCl@ss | Shipped on ICE | ADRSuff | Net Weight | Tariff Number | Menge pro VE | Bestell Nr. | |
|---|---|---|---|---|---|---|---|
  | 32160000 | STD | 1 | STOT RE 2,Aquatic Acute 1,Aquatic Chronic 1 | H373-H400-H410 | 1 | 1075203-2G |