01904 488599Captopril
Captopril, United States Pharmacopeia (USP) Reference Standard
| technique(s): | May cause an allergic skin reaction. Suspected of damaging fertility or the unborn child. |
| manufacturer/tradename: | GHS08,GHS07 |
| Antibody Form: | P280 |
| species reactivity: | 29339980900 |
| MSDS Link: | 1S/C9H15NO3S/c1-6(5-14)8(11)10-4-2-3-7(10)9(12)13/h6-7,14H,2-5H2,1H3,(H,12,13)/t6-,7+/m1/s1 |
| clone: | C[C@H](CS)C(=O)N1CCC[C@H]1C(O)=O |
| Gene Information: | human ... ACE(1636) |
| Antibody Product Type: | pharmaceutical (small molecule) |
| CAS-Nummer: | 62571-86-2 |
| eCl@ss | Shipped on ICE | ADRSuff | Net Weight | Tariff Number | Menge pro VE | Bestell Nr. | |
|---|---|---|---|---|---|---|---|
  | 32160000 | STD | 1 | Skin Sens. 1,Repr. 2 | H317-H361 | 1 | 1091200-200MG |