Carvedilol
Carvedilol, United States Pharmacopeia (USP) Reference Standard
| technique(s): | Toxic to aquatic life with long lasting effects. |
| manufacturer/tradename: | GHS09 |
| species reactivity: | 29339980900 |
| MSDS Link: | USP |
| Antibody Product Type: | pharmaceutical primary standard |
| clone: | COc1ccccc1OCCNCC(O)COc2cccc3[nH]c4ccccc4c23 |
| Gene Information: | pharmaceutical (small molecule) |
| CAS-Nummer: | 72956-09-3 |
X
Kunden kauften auch:
| eCl@ss | Shipped on ICE | ADRSuff | Net Weight | Tariff Number | Menge pro VE | Bestell Nr. | |
|---|---|---|---|---|---|---|---|
![]() | 32160000 | STD | 1 | Aquatic Chronic 2 | H411 | 1 | 1096622-200MG |

