01904 488599Chlorpropamide
Chlorpropamide, United States Pharmacopeia (USP) Reference Standard
| technique(s): | Harmful in contact with skin. Harmful if inhaled. Suspected of causing cancer. |
| manufacturer/tradename: | GHS08,GHS07 |
| Antibody Form: | P261 - P280 |
| species reactivity: | 29359090990 |
| MSDS Link: | pharmaceutical primary standard |
| Gene Information: | human ... ABCC8(6833), KCNJ11(3767) |
| clone: | CCCNC(=O)NS(=O)(=O)c1ccc(Cl)cc1 |
| Antibody Product Type: | pharmaceutical (small molecule) |
| CAS-Nummer: | 94-20-2 |
X
Kunden kauften auch:
| eCl@ss | Shipped on ICE | ADRSuff | Net Weight | Tariff Number | Menge pro VE | Bestell Nr. | |
|---|---|---|---|---|---|---|---|
  | 32160000 | STD | 1 | Acute Tox. 4,Acute Tox. 4,Carc. 2 | H312-H332-H351 | 1 | 1126009-200MG |