01904 488599Dexamethasone sodium phosphate
Dexamethasone sodium phosphate, United States Pharmacopeia (USP) Reference Standard
| manufacturer/tradename: | GHS08,GHS07 |
| Antibody Form: | P280 - P301 + P312 + P330 |
| species reactivity: | 29372200000 |
| MSDS Link: | pharmaceutical primary standard |
| Gene Information: | human ... NR3C1(2908) |
| clone: | [Na+].[Na+].[H][C@@]12CCC3=CC(=O)C=C[C@]3(C)[C@@]1(F)[C@@H](O)C[C@@]4(C)[C@@]2([H])C[C@@H](C)[C@]4(O)C(=O)COP([O-])([O-])=O |
| Antibody Product Type: | pharmaceutical (small molecule) |
| CAS-Nummer: | 2392-39-4 |
X
Kunden kauften auch:
| eCl@ss | Shipped on ICE | Net Weight | Tariff Number | technique(s) | Menge pro VE | Bestell Nr. | |
|---|---|---|---|---|---|---|---|
  | 32160000 | WICE | Acute Tox. 4,Carc. 2,Repr. 2 | H302-H351-H361 | Harmful if swallowed. Suspected of causing cancer. Suspected of damaging fertility or the unborn child. | 1 | 1177032-500MG |