01904 488599Dibutyl phthalate
Dibutyl phthalate, United States Pharmacopeia (USP) Reference Standard
| technique(s): | May damage the unborn child. Suspected of damaging fertility. Very toxic to aquatic life. |
| manufacturer/tradename: | GHS08,GHS09 |
| Antibody Form: | P201 - P280 - P308 + P313 |
| species reactivity: | 29173400400 |
| MSDS Link: | CCCCOC(=O)c1ccccc1C(=O)OCCCC |
| clone: | 340 C (lit.) |
| Quality Level: | 756 F |
| Antibody Product Type: | pharmaceutical (small molecule) |
| CAS-Nummer: | 84-74-2 |
X
Kunden kauften auch:
| eCl@ss | Shipped on ICE | ADRSuff | Net Weight | Tariff Number | Menge pro VE | Bestell Nr. | |
|---|---|---|---|---|---|---|---|
  | 32160000 | STD | 1 | Repr. 1B,Aquatic Acute 1 | H360Df-H400 | 1 | 1187080-200MG |