01904 488599Estradiol cypionate
Estradiol cypionate, United States Pharmacopeia (USP) Reference Standard
| technique(s): | Harmful if swallowed. Harmful in contact with skin. Harmful if inhaled. May cause cancer. May damage fertility or the unborn ch |
| manufacturer/tradename: | GHS08,GHS07 |
| Antibody Form: | P201 - P261 - P280 - P301 + P312 + P330 - P308 + P313 |
| species reactivity: | 29372300000 |
| MSDS Link: | 1S/C26H36O3/c1-26-15-14-21-20-10-8-19(27)16-18(20)7-9-22(21)23(26)11-12-24(26)29-25(28)13-6-17-4-2-3-5-17/h8,10,16-17,21-24,27H |
| Gene Information: | [H][C@]12CC[C@]3(C)[C@H](CC[C@@]3([H])[C@]1([H])CCc4cc(O)ccc24)OC(=O)CCC5CCCC5 |
| clone: | neat |
| Antibody Product Type: | pharmaceutical (small molecule) |
| CAS-Nummer: | 313-06-4 |
X
Kunden kauften auch:
| eCl@ss | Shipped on ICE | ADRSuff | Net Weight | Tariff Number | Menge pro VE | Bestell Nr. | |
|---|---|---|---|---|---|---|---|
  | 32160000 | STD | 1 | Acute Tox. 4,Acute Tox. 4,Acute Tox. 4,Carc. 1B,Repr. 1B | H302-H312-H332-H350-H360 | 1 | 1252003-200MG |