01904 488599Estriol
Estriol, United States Pharmacopeia (USP) Reference Standard
| technique(s): | Suspected of causing cancer. May damage fertility or the unborn child. |
| manufacturer/tradename: | GHS08 |
| Antibody Form: | P201 - P280 - P308 + P313 |
| species reactivity: | 29372300000 |
| MSDS Link: | C[C@]12CC[C@H]3[C@@H](CCc4cc(O)ccc34)[C@@H]1C[C@@H](O)[C@@H]2O |
| clone: | 280-282 C (lit.) |
| Antibody Product Type: | pharmaceutical (small molecule) |
| CAS-Nummer: | 50-27-1 |
| eCl@ss | Shipped on ICE | ADRSuff | Net Weight | Tariff Number | Menge pro VE | Bestell Nr. | |
|---|---|---|---|---|---|---|---|
  | 32160000 | STD | 1 | Carc. 2,Repr. 1B | H351-H360 | 1 | 1254508-100MG |