01904 488599Ethynodiol diacetate
Ethynodiol diacetate, United States Pharmacopeia (USP) Reference Standard
| technique(s): | Harmful if swallowed. Harmful in contact with skin. Harmful if inhaled. Suspected of causing cancer. |
| manufacturer/tradename: | GHS08,GHS07 |
| Antibody Form: | P261 - P280 - P301 + P312 + P330 |
| species reactivity: | 29372300000 |
| MSDS Link: | 1S/C24H32O4/c1-5-24(28-16(3)26)13-11-22-21-8-6-17-14-18(27-15(2)25)7-9-19(17)20(21)10-12-23(22,24)4/h1,14,18-22H,6-13H2,2-4H3/t |
| Gene Information: | human ... PGR(5241) |
| clone: | [H][C@]12CC[C@H](OC(C)=O)C=C1CC[C@]3([H])[C@]2([H])CC[C@@]4(C)[C@@]3([H])CC[C@@]4(OC(C)=O)C#C |
| Antibody Product Type: | pharmaceutical (small molecule) |
| CAS-Nummer: | 297-76-7 |
X
Kunden kauften auch:
| eCl@ss | Shipped on ICE | ADRSuff | Net Weight | Tariff Number | Menge pro VE | Bestell Nr. | |
|---|---|---|---|---|---|---|---|
  | 32160000 | STD | 1 | Acute Tox. 4,Acute Tox. 4,Acute Tox. 4,Carc. 2 | H302-H312-H332-H351 | 1 | 1268003-200MG |