01904 488599Lisinopril
Lisinopril, United States Pharmacopeia (USP) Reference Standard
| technique(s): | May damage fertility or the unborn child. May cause damage to organs through prolonged or repeated exposure. |
| manufacturer/tradename: | GHS08 |
| Antibody Form: | P201 - P260 - P280 - P308 + P313 |
| species reactivity: | 29339980900 |
| MSDS Link: | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DE&language=EN&productNumber=1368609&brand=SIAL |
| Antibody Product Type: | [H]O[H].[H]O[H].NCCCC[C@H](N[C@@H](CCc1ccccc1)C(O)=O)C(=O)N2CCC[C@H]2C(O)=O |
| clone: | neat |
| Gene Information: | pharmaceutical (small molecule) |
| CAS-Nummer: | 83915-83-7 |
X
Kunden kauften auch:
| eCl@ss | Shipped on ICE | ADRSuff | Net Weight | Tariff Number | Menge pro VE | Bestell Nr. | |
|---|---|---|---|---|---|---|---|
  | 32160000 | STD | 1 | Repr. 1A,STOT RE 2 | H360-H373 | 1 | 1368609-300MG |