01904 488599Megestrol acetate
Megestrol acetate, United States Pharmacopeia (USP) Reference Standard
| technique(s): | Suspected of causing cancer. May cause damage to organs through prolonged or repeated exposure. |
| manufacturer/tradename: | GHS08 |
| Antibody Form: | P260 - P280 |
| species reactivity: | 29372300000 |
| MSDS Link: | pharmaceutical primary standard |
| Gene Information: | [H][C@]12CC[C@@]3(C)[C@@]([H])(CC[C@]3(OC(C)=O)C(C)=O)[C@]1([H])C=C(C)C4=CC(=O)CC[C@]24C |
| clone: | 2-8C |
| Antibody Product Type: | pharmaceutical (small molecule) |
| CAS-Nummer: | 595-33-5 |
X
Kunden kauften auch:
| eCl@ss | Shipped on ICE | ADRSuff | Net Weight | Tariff Number | Menge pro VE | Bestell Nr. | |
|---|---|---|---|---|---|---|---|
  | 32160000 | WICE | 1 | Carc. 2,STOT RE 2 | H351-H373 | 1 | 1379106-250MG |