01904 488599Melengestrol acetate
Melengestrol acetate, United States Pharmacopeia (USP) Reference Standard
| technique(s): | Suspected of damaging fertility or the unborn child. |
| manufacturer/tradename: | GHS08 |
| Antibody Form: | P280 |
| species reactivity: | 29372300000 |
| MSDS Link: | 1S/C25H32O4/c1-14-11-19-20(23(5)9-7-18(28)13-21(14)23)8-10-24(6)22(19)12-15(2)25(24,16(3)26)29-17(4)27/h11,13,19-20,22H,2,7-10, |
| clone: | [H][C@]12CC[C@@]3(C)[C@@]([H])(CC(=C)[C@]3(OC(C)=O)C(C)=O)[C@]1([H])C=C(C)C4=CC(=O)CC[C@]24C |
| Antibody Product Type: | pharmaceutical (small molecule) |
| CAS-Nummer: | 2919-66-6 |
X
Kunden kauften auch:
| eCl@ss | Shipped on ICE | ADRSuff | Net Weight | Tariff Number | Menge pro VE | Bestell Nr. | |
|---|---|---|---|---|---|---|---|
  | 32160000 | DICE | 1 | Repr. 2 | H361 | 1 | 1379254-125MG |