01904 488599Methscopolamine bromide
Methscopolamine bromide, United States Pharmacopeia (USP) Reference Standard
| technique(s): | Harmful in contact with skin. Harmful if inhaled. Very toxic to aquatic life. |
| manufacturer/tradename: | GHS07,GHS09 |
| Antibody Form: | P261 - P280 |
| species reactivity: | 29397990900 |
| MSDS Link: | pharmaceutical primary standard |
| clone: | [Br-].[H][C@]12C[C@@H](C[C@]([H])([C@@]3([H])O[C@@]13[H])[N+]2(C)C)OC(=O)[C@H](CO)c4ccccc4 |
| Gene Information: | human ... CHRM1(1128), CHRM3(1131) |
| Antibody Product Type: | pharmaceutical (small molecule) |
| CAS-Nummer: | 155-41-9 |
X
Kunden kauften auch:
| eCl@ss | Shipped on ICE | ADRSuff | Net Weight | Tariff Number | Menge pro VE | Bestell Nr. | |
|---|---|---|---|---|---|---|---|
  | 32160000 | STD | 1 | Acute Tox. 4,Acute Tox. 4,Aquatic Acute 1 | H312-H332-H400 | 1 | 1421009-200MG |