Methyl benzylidene camphor
Methyl benzylidene camphor, United States Pharmacopeia (USP) Reference Standard
| technique(s): | Suspected of damaging fertility or the unborn child. |
| manufacturer/tradename: | GHS08 |
| Antibody Form: | P280 |
| species reactivity: | 29143900900 |
| MSDS Link: | Cc1ccc(cc1)\C=C2\[C@@H]3CC[C@](C)(C2=O)C3(C)C |
| clone: | 1S/C18H22O/c1-12-5-7-13(8-6-12)11-14-15-9-10-18(4,16(14)19)17(15,2)3/h5-8,11,15H,9-10H2,1-4H3/b14-11-/t15-,18+/m0/s1 |
| Antibody Product Type: | pharmaceutical (small molecule) |
| CAS-Nummer: | 36861-47-9 |
X
Kunden kauften auch:
| eCl@ss | Shipped on ICE | ADRSuff | Net Weight | Tariff Number | Menge pro VE | Bestell Nr. | |
|---|---|---|---|---|---|---|---|
![]() | 32160000 | STD | 1 | Repr. 2 | H361 | 1 | 1424222-200MG |

