01904 4885995-Ethylidene-2-norbornene
5-Ethylidene-2-norbornene, contains 100-700 ppm BHT as inhibitor, mixture of endo and exo, 99%
| technique(s): | 3 |
| manufacturer/tradename: | Flammable liquid, n.o.s. |
| species reactivity: | Danger |
| clone: | Xn,N |
| Quality Level: | Harmful, Dangerous for the environment |
| Antibody Product Type: | MFCD00167576 |
| NCBI accession no.: | C9H12 |
| biological source: | 5-ETHYLIDENE-2-NORBORNENE |
| MSDS Link: | C\C=C1/C[C@H]2C[C@@H]1C=C2 |
| CAS-Nummer: | 16219-75-3 |
X
Kunden kauften auch:
| eCl@ss | Shipped on ICE | ADRSuff | Net Weight | Tariff Number | Antibody Form | Menge pro VE | Bestell Nr. | |
|---|---|---|---|---|---|---|---|---|
  | 32160000 | STD | CN | 3 | X | P273 - P301 + P310 - P331 | 1 | 151467-100ML |
| 32160000 | STD | CN | 3 | X | P273 - P301 + P310 - P331 | 1 | 151467-2L |
| 32160000 | STD | CN | 3 | X | Flammable liquid and vapour. May be fatal if swallowed and enters airways. Causes skin irritation. Harmful if inhaled. May caus | 1 | 151467-500ML |