01904 488599Prednisone
Prednisone, United States Pharmacopeia (USP) Reference Standard
| technique(s): | May cause damage to organs through prolonged or repeated exposure. May cause damage to organs through prolonged or repeated exp |
| manufacturer/tradename: | GHS08 |
| Antibody Form: | P260 |
| species reactivity: | 29372100000 |
| MSDS Link: | pharmaceutical primary standard |
| Gene Information: | 236-238 C (lit.) |
| clone: | O=C1C=C[C@@]2(C)C(CC[C@]([C@@](CC[C@@]3(C(CO)=O)O)([H])[C@]3(C)C4)([H])[C@]2([H])C4=O)=C1 |
| Antibody Product Type: | pharmaceutical (small molecule) |
| CAS-Nummer: | 53-03-2 |
X
Kunden kauften auch:
| eCl@ss | Shipped on ICE | ADRSuff | Net Weight | Tariff Number | Menge pro VE | Bestell Nr. | |
|---|---|---|---|---|---|---|---|
  | 32160000 | STD | 1 | STOT RE 2,STOT RE 2 | H373-H373 | 1 | 1559006-250MG |