01904 488599Progesterone
Progesterone, United States Pharmacopeia (USP) Reference Standard
| technique(s): | Suspected of causing cancer. May damage fertility or the unborn child. |
| manufacturer/tradename: | GHS08 |
| Antibody Form: | P201 - P280 - P308 + P313 |
| species reactivity: | 29372300000 |
| MSDS Link: | pharmaceutical primary standard |
| Gene Information: | CC(=O)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| Antibody Product Type: | RJKFOVLPORLFTN-LEKSSAKUSA-N |
| clone: | pharmaceutical (small molecule) |
| CAS-Nummer: | 57-83-0 |
X
Kunden kauften auch:
| eCl@ss | Shipped on ICE | ADRSuff | Net Weight | Tariff Number | Menge pro VE | Bestell Nr. | |
|---|---|---|---|---|---|---|---|
  | 32160000 | STD | 1 | Carc. 2,Repr. 1B | H351-H360 | 1 | 1568007-200MG |