01904 488599Risedronate sodium
Risedronate sodium, United States Pharmacopeia (USP) Reference Standard
| technique(s): | Harmful if swallowed. Causes serious eye irritation. Suspected of damaging fertility or the unborn child. May cause damage to o |
| manufacturer/tradename: | GHS08,GHS07 |
| Antibody Form: | P260 - P281 - P305 + P351 + P338 - P308 + P311 |
| species reactivity: | 29333999900 |
| MSDS Link: | OP(C(P(O)([O-])=O)(O)CC1=CC=CN=C1)(O)=O.[Na+] |
| clone: | pharmaceutical (small molecule) |
| CAS-Nummer: | 329003-65-8 |
X
Kunden kauften auch:
| eCl@ss | Shipped on ICE | ADRSuff | Net Weight | Tariff Number | Menge pro VE | Bestell Nr. | |
|---|---|---|---|---|---|---|---|
  | 32160000 | STD | 1 | Acute Tox. 4,Eye Irrit. 2,Repr. 2,STOT SE 2 | H302-H319-H361-H371 | 1 | 1604610-350MG |