01904 488599Tetracycline hydrochloride
Tetracycline hydrochloride, United States Pharmacopeia (USP) Reference Standard
| technique(s): | Suspected of damaging fertility or the unborn child. Toxic to aquatic life with long lasting effects. |
| manufacturer/tradename: | GHS08,GHS09 |
| Antibody Form: | P280 |
| species reactivity: | 29413000000 |
| MSDS Link: | pharmaceutical primary standard |
| clone: | Cl.CN(C)[C@H]1[C@@H]2C[C@H]3C(=C(O)[C@]2(O)C(=O)C(C(N)=O)=C1O)C(=O)c4c(O)cccc4[C@@]3(C)O |
| Antibody Product Type: | pharmaceutical (small molecule) |
| CAS-Nummer: | 64-75-5 |
X
Kunden kauften auch:
| eCl@ss | Shipped on ICE | ADRSuff | Net Weight | Tariff Number | Menge pro VE | Bestell Nr. | |
|---|---|---|---|---|---|---|---|
  | 32160000 | WICE | 1 | Repr. 2,Aquatic Chronic 2 | H361-H411 | 1 | 1651009-200MG |